* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00441006 |
| English Synonyms: | LABOTEST-BB LT00441006 |
| MDL Number.: | MFCD00063907 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | CC(=O)N[C@@H](Cc1c[nH]cn1)C(=O)O |
| InChi: | InChI=1S/C8H11N3O3/c1-5(12)11-7(8(13)14)2-6-3-9-4-10-6/h3-4,7H,2H2,1H3,(H,9,10)(H,11,12)(H,13,14)/t7-/m0/s1 |
| InChiKey: | InChIKey=KBOJOGQFRVVWBH-ZETCQYMHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.