* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT03330067 |
| English Synonyms: | LABOTEST-BB LT03330067 |
| MDL Number.: | MFCD00063927 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)C[C@H](C(=O)O)N |
| InChi: | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m1/s1 |
| InChiKey: | InChIKey=COLNVLDHVKWLRT-MRVPVSSYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.