* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00455035 |
| English Synonyms: | LABOTEST-BB LT00455035 |
| MDL Number.: | MFCD00063933 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(C)CCC[C@H](C)[C@@H]1CC[C@H]2[C@]1(CC[C@@H]3[C@@H]2CC=C4[C@]3(CC[C@H](C4)OC(=O)C)C)C |
| InChi: | InChI=1S/C29H48O2/c1-19(2)8-7-9-20(3)25-12-13-26-24-11-10-22-18-23(31-21(4)30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10,19-20,23-27H,7-9,11-18H2,1-6H3/t20-,23+,24+,25-,26+,27+,28+,29-/m0/s1 |
| InChiKey: | InChIKey=XUGISPSHIFXEHZ-NMFQTIMSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.