* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-(-)-GLUCOSE |
| English Synonyms: | L-(-)-GLUCOSE ; (3S,4R,5R,6S)-6-(HYDROXYMETHYL)OXANE-2,3,4,5-TETROL ; L-GLUCOSE |
| MDL Number.: | MFCD00063958 |
| H bond acceptor: | 6 |
| H bond donor: | 5 |
| Smile: | C([C@H]1[C@@H]([C@H]([C@@H](C(O1)O)O)O)O)O |
| InChi: | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6?/m0/s1 |
| InChiKey: | InChIKey=WQZGKKKJIJFFOK-ZZWDRFIYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.