* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT03328873 |
| English Synonyms: | LABOTEST-BB LT03328873 |
| MDL Number.: | MFCD00063990 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | C([C@@H](C(=O)O)O)C(=O)O |
| InChi: | InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/t2-/m0/s1 |
| InChiKey: | InChIKey=BJEPYKJPYRNKOW-REOHCLBHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.