* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | D-LACTOSE |
CAS: | 14641-93-1 |
English Synonyms: | ALPHA-LACTOSE ; D-LACTOSE |
MDL Number.: | MFCD00064074 |
H bond acceptor: | 11 |
H bond donor: | 8 |
Smile: | C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@@H]([C@@H]([C@H]2O)O)O)CO)O)O)O)O |
InChi: | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11+,12+/m1/s1 |
InChiKey: | InChIKey=GUBGYTABKSRVRQ-XLOQQCSPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.