* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00847696 |
| English Synonyms: | LABOTEST-BB LT00847696 |
| MDL Number.: | MFCD00064098 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | c1ccc(cc1)COC(=O)NCCCC[C@@H](C(=O)O)N |
| InChi: | InChI=1S/C14H20N2O4/c15-12(13(17)18)8-4-5-9-16-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18)/t12-/m0/s1 |
| InChiKey: | InChIKey=CKGCFBNYQJDIGS-LBPRGKRZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.