* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | R-RIBOSE |
CAS: | 10257-32-6 |
English Synonyms: | D-RIBOPYRANOSE ; R-RIBOSE ; (3R,4R,5R)-OXANE-2,3,4,5-TETROL |
MDL Number.: | MFCD00064364 |
H bond acceptor: | 5 |
H bond donor: | 4 |
Smile: | C1[C@H]([C@H]([C@H](C(O1)O)O)O)O |
InChi: | InChI=1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4-,5?/m1/s1 |
InChiKey: | InChIKey=SRBFZHDQGSBBOR-SOOFDHNKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.