* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00454368 |
| English Synonyms: | LABOTEST-BB LT00454368 |
| MDL Number.: | MFCD00064787 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1cc(ccc1/C(=C/2\C=CC(=O)C=C2C)/c3ccccc3S(=O)(=O)[O-])O.[Na+] |
| InChi: | InChI=1S/C21H18O5S.Na/c1-13-11-15(22)7-9-17(13)21(18-10-8-16(23)12-14(18)2)19-5-3-4-6-20(19)27(24,25)26;/h3-12,22H,1-2H3,(H,24,25,26);/q;+1/p-1/b21-18-; |
| InChiKey: | InChIKey=BYQJYOOKENJSNK-WIPIHYDQSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.