* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00159733 |
| English Synonyms: | LABOTEST-BB LT00159733 |
| MDL Number.: | MFCD00064867 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | Cc1cc(ccc1O)/C(=C/2\C=CC(=O)C(=C2)C)/c3ccccc3S(=O)(=O)O |
| InChi: | InChI=1S/C21H18O5S/c1-13-11-15(7-9-18(13)22)21(16-8-10-19(23)14(2)12-16)17-5-3-4-6-20(17)27(24,25)26/h3-12,22H,1-2H3,(H,24,25,26)/b21-16- |
| InChiKey: | InChIKey=DYXFNDRXWAWZBN-PGMHBOJBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.