* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-L-METHIONYL GLYCINE |
| CAS: | 13139-55-4 |
| English Synonyms: | Z-MET-GLY-OH ; Z-L-METHIONYL GLYCINE |
| MDL Number.: | MFCD00065162 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CSCC[C@@H](C(=O)NCC(=O)O)NC(=O)OCc1ccccc1 |
| InChi: | InChI=1S/C15H20N2O5S/c1-23-8-7-12(14(20)16-9-13(18)19)17-15(21)22-10-11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3,(H,16,20)(H,17,21)(H,18,19)/t12-/m0/s1 |
| InChiKey: | InChIKey=SCCXGVZPVRHHBX-LBPRGKRZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.