* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XYLENOL-ORANGE |
| English Synonyms: | XYLENOL-ORANGE |
| MDL Number.: | MFCD00065387 |
| H bond acceptor: | 15 |
| H bond donor: | 6 |
| Smile: | Cc1cc(cc(c1O)CN(CC(=O)O)CC(=O)O)/C(=C\2/C=C(C(=O)C(=C2)CN(CC(=O)O)CC(=O)O)C)/c3ccccc3S(=O)(=O)O |
| InChi: | InChI=1S/C31H32N2O13S/c1-17-7-19(9-21(30(17)42)11-32(13-25(34)35)14-26(36)37)29(23-5-3-4-6-24(23)47(44,45)46)20-8-18(2)31(43)22(10-20)12-33(15-27(38)39)16-28(40)41/h3-10,42H,11-16H2,1-2H3,(H,34,35)(H,36,37)(H,38,39)(H,40,41)(H,44,45,46)/b29-20+ |
| InChiKey: | InChIKey=SESORLVFYDXIDP-ZTKZIYFRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.