* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-7-DECEN-1-YL ACETATE |
CAS: | 13857-03-9 |
English Synonyms: | CIS-7-DECEN-1-YL ACETATE ; Z-7-DECEN-1-YL ACETATE |
MDL Number.: | MFCD00065427 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC/C=C\CCCCCCOC(=O)C |
InChi: | InChI=1S/C12H22O2/c1-3-4-5-6-7-8-9-10-11-14-12(2)13/h4-5H,3,6-11H2,1-2H3/b5-4- |
InChiKey: | InChIKey=DEOHUYGDZACDBU-PLNGDYQASA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.