* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9(E),11(E),13(E),15(E)-OCTADECATETRAENOIC ACID |
| CAS: | 18841-21-9 |
| English Synonyms: | 9(E),11(E),13(E),15(E)-OCTADECATETRAENOIC ACID ; TRANS-PARINARIC ACID |
| MDL Number.: | MFCD00065484 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC/C=C/C=C/C=C/C=C/CCCCCCCC(=O)O |
| InChi: | InChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-10H,2,11-17H2,1H3,(H,19,20)/b4-3+,6-5+,8-7+,10-9+ |
| InChiKey: | InChIKey=IJTNSXPMYKJZPR-BYFNFPHLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.