* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LEUKOTRIENE E5 |
| CAS: | 79695-14-0 |
| English Synonyms: | LEUKOTRIENE E5 |
| MDL Number.: | MFCD00065880 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H]([C@H](CCCC(=O)O)O)SC[C@H](C(=O)O)N |
| InChi: | InChI=1S/C23H35NO5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-21(30-18-19(24)23(28)29)20(25)15-14-17-22(26)27/h3-4,6-7,9-13,16,19-21,25H,2,5,8,14-15,17-18,24H2,1H3,(H,26,27)(H,28,29)/b4-3-,7-6-,10-9-,12-11+,16-13+/t19-,20+,21-/m1/s1 |
| InChiKey: | InChIKey=FTIGTMSREJDHKN-REPGQKQESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.