* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOCITRIC ACID |
English Synonyms: | ISOCITRIC ACID |
MDL Number.: | MFCD00065926 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | C(C(C(C(=O)O)O)C(=O)O)C(=O)O |
InChi: | InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13) |
InChiKey: | InChIKey=ODBLHEXUDAPZAU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.