* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-ALA-ASN-OH |
CAS: | 31796-57-3 |
English Synonyms: | L-ALANYL-L-ASPARAGINE ; H-ALA-ASN-OH |
MDL Number.: | MFCD00066032 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | C[C@@H](C(=O)N[C@@H](CC(=O)N)C(=O)O)N |
InChi: | InChI=1S/C7H13N3O4/c1-3(8)6(12)10-4(7(13)14)2-5(9)11/h3-4H,2,8H2,1H3,(H2,9,11)(H,10,12)(H,13,14)/t3-,4-/m0/s1 |
InChiKey: | InChIKey=CCUAQNUWXLYFRA-IMJSIDKUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.