* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | D-ALA-LEU |
| CAS: | 67113-60-4 |
| English Synonyms: | D-ALA-LEU ; D-ALA-LEU-OH ; H-D-ALA-LEU-OH ; D-ALANYL-L-LEUCINE |
| MDL Number.: | MFCD00066033 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | CC(C)C[C@@H](C(=O)O)NC(=O)[C@@H](C)N |
| InChi: | InChI=1S/C9H18N2O3/c1-5(2)4-7(9(13)14)11-8(12)6(3)10/h5-7H,4,10H2,1-3H3,(H,11,12)(H,13,14)/t6-,7+/m1/s1 |
| InChiKey: | InChIKey=RDIKFPRVLJLMER-RQJHMYQMSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.