* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-ALA-MET-OH |
CAS: | 14486-05-6 |
English Synonyms: | H-ALA-MET-OH ; L-ALANYL-L-METHIONINE |
MDL Number.: | MFCD00066034 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | C[C@@H](C(=O)N[C@@H](CCSC)C(=O)O)N |
InChi: | InChI=1S/C8H16N2O3S/c1-5(9)7(11)10-6(8(12)13)3-4-14-2/h5-6H,3-4,9H2,1-2H3,(H,10,11)(H,12,13)/t5-,6-/m0/s1 |
InChiKey: | InChIKey=FSHURBQASBLAPO-WDSKDSINSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.