* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00453594 |
| English Synonyms: | LABOTEST-BB LT00453594 |
| MDL Number.: | MFCD00066632 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | C[N+](=c1ccc-2nc3c(cc(c(c3oc2c1)O)O)C(=O)O)C.[Cl-] |
| InChi: | InChI=1S/C15H12N2O5.ClH/c1-17(2)7-3-4-9-11(5-7)22-14-12(16-9)8(15(20)21)6-10(18)13(14)19;/h3-6H,1-2H3,(H2,16,19,20,21);1H |
| InChiKey: | InChIKey=LQCYOANSIWHRFN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.