* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AX KI 5029 |
English Synonyms: | RARECHEM AX KI 5029 |
MDL Number.: | MFCD00066763 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CO)O)C)O)F)C |
InChi: | InChI=1S/C22H29FO5/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24/h6-7,9,12,15-17,24,26,28H,4-5,8,10-11H2,1-3H3 |
InChiKey: | InChIKey=UREBDLICKHMUKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.