* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LTBB003216 |
| English Synonyms: | LABOTEST-BB LTBB003216 |
| MDL Number.: | MFCD00066792 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | B.CN(C)C |
| InChi: | InChI=1S/C3H9N.BH3/c1-4(2)3;/h1-3H3;1H3 |
| InChiKey: | InChIKey=WVMHLYQJPRXKLC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.