* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00452806 |
| English Synonyms: | LABOTEST-BB LT00452806 |
| MDL Number.: | MFCD00066879 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc(c(c1)c2c3ccc(c(c3oc-4c(c(=O)ccc24)Br)Br)O)C(=O)O |
| InChi: | InChI=1S/C20H10Br2O5/c21-16-13(23)7-5-11-15(9-3-1-2-4-10(9)20(25)26)12-6-8-14(24)17(22)19(12)27-18(11)16/h1-8,23H,(H,25,26) |
| InChiKey: | InChIKey=YVPBVWICNJPHCW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.