* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00244848 |
| English Synonyms: | LABOTEST-BB LT00244848 |
| MDL Number.: | MFCD00066884 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(=O)C1CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C |
| InChi: | InChI=1S/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3 |
| InChiKey: | InChIKey=RJKFOVLPORLFTN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.