* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LEAD ADIPATE |
| English Synonyms: | LEAD ADIPATE |
| MDL Number.: | MFCD00067210 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | C1CCC(=O)O[Pb]OC(=O)C1 |
| InChi: | InChI=1S/C6H10O4.Pb/c7-5(8)3-1-2-4-6(9)10;/h1-4H2,(H,7,8)(H,9,10);/q;+2/p-2 |
| InChiKey: | InChIKey=SGDZCVOHXFLTPM-UHFFFAOYSA-L |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.