* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LITHIUM HEPTANOATE |
| English Synonyms: | LITHIUM HEPTANOATE |
| MDL Number.: | MFCD00067215 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | [Li+].CCCCCCC(=O)[O-] |
| InChi: | InChI=1S/C7H14O2.Li/c1-2-3-4-5-6-7(8)9;/h2-6H2,1H3,(H,8,9);/q;+1/p-1 |
| InChiKey: | InChIKey=RQZHWDLISAJCLK-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.