* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LEAD SEBACATE |
| CAS: | 29473-77-6 |
| English Synonyms: | LEAD SEBACATE |
| MDL Number.: | MFCD00067241 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | C1CCCCC(=O)O[Pb]OC(=O)CCC1 |
| InChi: | InChI=1S/C10H18O4.Pb/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;/h1-8H2,(H,11,12)(H,13,14);/q;+2/p-2 |
| InChiKey: | InChIKey=QCWKNPBWGUZSTH-UHFFFAOYSA-L |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.