* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | D-SACCHARIC ACID 3,6-LACTONE |
| CAS: | 2782-04-9 |
| English Synonyms: | D-SACCHARIC ACID 3,6-LACTONE |
| MDL Number.: | MFCD00067299 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | [C@@H]1([C@@H](C(=O)O[C@@H]1[C@H](C(=O)O)O)O)O |
| InChi: | InChI=1S/C6H8O7/c7-1-2(8)6(12)13-4(1)3(9)5(10)11/h1-4,7-9H,(H,10,11)/t1-,2-,3+,4-/m0/s1 |
| InChiKey: | InChIKey=XECPAIJNBXCOBO-QDQPNEQZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.