* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FERROUS NICOTINATE |
| CAS: | 10361-13-4 |
| English Synonyms: | FERROUS NICOTINATE |
| MDL Number.: | MFCD00067339 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | c1cc(cnc1)C(=O)O[Fe]OC(=O)c2cccnc2 |
| InChi: | InChI=1S/2C6H5NO2.Fe/c2*8-6(9)5-2-1-3-7-4-5;/h2*1-4H,(H,8,9);/q;;+2/p-2 |
| InChiKey: | InChIKey=SLSOHEBQPQLNCI-UHFFFAOYSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.