* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLYCYL-D-THREONINE |
CAS: | 7361-42-4 |
English Synonyms: | H-GLY-D-THR-OH ; GLYCYL-D-THREONINE |
MDL Number.: | MFCD00067443 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | C[C@@H]([C@H](C(=O)O)NC(=O)CN)O |
InChi: | InChI=1S/C6H12N2O4/c1-3(9)5(6(11)12)8-4(10)2-7/h3,5,9H,2,7H2,1H3,(H,8,10)(H,11,12)/t3-,5+/m0/s1 |
InChiKey: | InChIKey=OLIFSFOFKGKIRH-WVZVXSGGSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.