* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00847605 |
| English Synonyms: | LABOTEST-BB LT00847605 |
| MDL Number.: | MFCD00067550 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C1CCN2C[C@@H]3C[C@H]([C@H]2C1)CN4[C@@H]3CCCC4.OS(=O)(=O)O |
| InChi: | InChI=1S/C15H26N2.H2O4S/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17;1-5(2,3)4/h12-15H,1-11H2;(H2,1,2,3,4)/t12-,13-,14+,15+;/m0./s1 |
| InChiKey: | InChIKey=FCEHFCFHANDXMB-FFIJQSHZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.