* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LEAD FUMARATE |
| English Synonyms: | LEAD FUMARATE |
| MDL Number.: | MFCD00067563 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | C1=CC(=O)O[Pb]OC1=O |
| InChi: | InChI=1S/C4H4O4.Pb/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+2/p-2/b2-1+; |
| InChiKey: | InChIKey=JJWLMSCSLRJSAN-TYYBGVCCSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.