* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZINC CAPROATE |
| CAS: | 20779-08-2 |
| English Synonyms: | ZINC CAPROATE |
| MDL Number.: | MFCD00068289 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCCCCC(=O)O[Zn]OC(=O)CCCCC |
| InChi: | InChI=1S/2C6H12O2.Zn/c2*1-2-3-4-5-6(7)8;/h2*2-5H2,1H3,(H,7,8);/q;;+2/p-2 |
| InChiKey: | InChIKey=PKJOUIVGCFHFTK-UHFFFAOYSA-L |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.