* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CALCIUM TARTRATE |
CAS: | 3164-34-9 ;5892-21-7 |
English Synonyms: | CALCIUM TARTRATE |
MDL Number.: | MFCD00068402 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | C1(C(C(=O)O[Ca]OC1=O)O)O |
InChi: | InChI=1S/C4H6O6.Ca/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+2/p-2 |
InChiKey: | InChIKey=GUPPESBEIQALOS-UHFFFAOYSA-L |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.