* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ORTHOCHROME T |
| CAS: | 6270-81-1 |
| English Synonyms: | ORTHOCHROME T |
| MDL Number.: | MFCD00068453 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC[n+]1c(ccc2c1ccc(c2)C)/C=C/3\C=CN(c4c3cc(cc4)C)CC.[I-] |
| InChi: | InChI=1S/C25H27N2.HI/c1-5-26-14-13-20(23-16-19(4)8-12-25(23)26)17-22-10-9-21-15-18(3)7-11-24(21)27(22)6-2;/h7-17H,5-6H2,1-4H3;1H/q+1;/p-1 |
| InChiKey: | InChIKey=SBUADOFQIFVSEJ-UHFFFAOYSA-M |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.