* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OTAVA-BB 1507124 |
English Synonyms: | OTAVA-BB 1507124 |
MDL Number.: | MFCD00068816 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCOc1ccc(c(c1OCC)OCC)C(=O)CCC(=O)O |
InChi: | InChI=1S/C16H22O6/c1-4-20-13-9-7-11(12(17)8-10-14(18)19)15(21-5-2)16(13)22-6-3/h7,9H,4-6,8,10H2,1-3H3,(H,18,19) |
InChiKey: | InChIKey=LPUHSIHEXXRLQW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.