* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00772237 |
| English Synonyms: | LABOTEST-BB LT00772237 |
| MDL Number.: | MFCD00069364 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CC[C@H]1[C@H](COC1=O)Cc2cncn2C.Cl |
| InChi: | InChI=1S/C11H16N2O2.ClH/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2;/h5,7-8,10H,3-4,6H2,1-2H3;1H/t8-,10-;/m0./s1 |
| InChiKey: | InChIKey=RNAICSBVACLLGM-GNAZCLTHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.