* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-PHENYLALANINE-UL-14C |
| CAS: | 658-69-5 |
| English Synonyms: | L-PHENYLALANINE-UL-14C ; PHENYLALANINE L-[14C(U)] |
| MDL Number.: | MFCD00069585 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | [14cH]1[14cH][14cH][14c]([14cH][14cH]1)[14CH2][14C@@H]([14C](=O)O)N |
| InChi: | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i1+2,2+2,3+2,4+2,5+2,6+2,7+2,8+2,9+2 |
| InChiKey: | InChIKey=COLNVLDHVKWLRT-BEVJTWNISA-N |
|
|
| Density: | DENSITY: 0.978 |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.