* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-THREONINE, [U-14C] |
| CAS: | 81325-81-7 |
| English Synonyms: | THREONINE, L-[14C(U)] ; L-THREONINE, [U-14C] |
| MDL Number.: | MFCD00069619 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | [14CH3][14C@H]([14C@@H]([14C](=O)O)N)O |
| InChi: | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1/i1+2,2+2,3+2,4+2 |
| InChiKey: | InChIKey=AYFVYJQAPQTCCC-LKHDQXDOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.