* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-NITROANILINE [14C(U)] |
CAS: | 78645-83-7 |
English Synonyms: | O-NITROANILINE, [14C(U)]- ; NITROANILINE-O [14C(U)] ; 2-NITROANILINE [14C(U)] |
MDL Number.: | MFCD00069910 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | [14cH]1[14cH][14cH][14c]([14c]([14cH]1)N)[N+](=O)[O-] |
InChi: | InChI=1S/C6H6N2O2/c7-5-3-1-2-4-6(5)8(9)10/h1-4H,7H2/i1+2,2+2,3+2,4+2,5+2,6+2 |
InChiKey: | InChIKey=DPJCXCZTLWNFOH-YROCTSJKSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.