* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | THIENAMYCIN |
CAS: | 59995-64-1 |
English Synonyms: | THIENAMYCIN |
MDL Number.: | MFCD00072032 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | C[C@H]([C@@H]1[C@H]2CC(=C(N2C1=O)C(=O)O)SCCN)O |
InChi: | InChI=1S/C11H16N2O4S/c1-5(14)8-6-4-7(18-3-2-12)9(11(16)17)13(6)10(8)15/h5-6,8,14H,2-4,12H2,1H3,(H,16,17)/t5-,6-,8-/m1/s1 |
InChiKey: | InChIKey=WKDDRNSBRWANNC-ATRFCDNQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.