* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00134662 |
| English Synonyms: | LABOTEST-BB LT00134662 |
| MDL Number.: | MFCD00072124 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(C)NCC(COc1ccc(cc1)CCOC)O.C(C(C(=O)O)O)(C(=O)O)O |
| InChi: | InChI=1S/C15H25NO3.C4H6O6/c1-12(2)16-10-14(17)11-19-15-6-4-13(5-7-15)8-9-18-3;5-1(3(7)8)2(6)4(9)10/h4-7,12,14,16-17H,8-11H2,1-3H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChiKey: | InChIKey=WPTKISQJQVFSQI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.