* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,4,6-TRIISOPROPYL-1,3,5-TRIOXANE |
CAS: | 7580-12-3 |
English Synonyms: | 2,4,6-TRIPROPAN-2-YL-1,3,5-TRIOXANE ; 2,4,6-TRIISOPROPYL-1,3,5-TRIOXANE ; 1,3,5-TRIOXANE,2,4,6-TRIS(1-METHYLETHYL)- |
MDL Number.: | MFCD00072685 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC(C)C1OC(OC(O1)C(C)C)C(C)C |
InChi: | InChI=1S/C12H24O3/c1-7(2)10-13-11(8(3)4)15-12(14-10)9(5)6/h7-12H,1-6H3 |
InChiKey: | InChIKey=XYIANCZIPATGDH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.