* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-ETHYLBICYCLO[3.3.1]NONAN-9-OL |
CAS: | 21915-33-3 |
English Synonyms: | 9-ETHYLBICYCLO[3.3.1]NONAN-9-OL |
MDL Number.: | MFCD00074758 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCC1([C@H]2CCC[C@@H]1CCC2)O |
InChi: | InChI=1S/C11H20O/c1-2-11(12)9-5-3-6-10(11)8-4-7-9/h9-10,12H,2-8H2,1H3/t9-,10+,11? |
InChiKey: | InChIKey=COQRKPRIDRDOOG-ZACCUICWSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.