* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUADRICYCLANE |
| CAS: | 278-06-8 |
| English Synonyms: | QUADRICYCLANE ; TETRACYCLO[3.2.0.0(2,7).0(4,6)]HEPTANE |
| MDL Number.: | MFCD00074761 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | C1[C@H]2[C@@H]3[C@H]2[C@@H]4[C@H]1[C@H]34 |
| InChi: | InChI=1S/C7H8/c1-2-4-5(2)7-3(1)6(4)7/h2-7H,1H2/t2-,3+,4+,5-,6+,7- |
| InChiKey: | InChIKey=DGZUEIPKRRSMGK-BEOVHNCFSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.