* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IBSCREEN-BB BB_NC-0046 |
English Synonyms: | IBSCREEN-BB BB_NC-0046 |
MDL Number.: | MFCD00075048 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc2n(c(=O)c1)C[C@@H]3C[C@H]2CNC3 |
InChi: | InChI=1S/C11H14N2O/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11/h1-3,8-9,12H,4-7H2/t8-,9+/m1/s1 |
InChiKey: | InChIKey=ANJTVLIZGCUXLD-BDAKNGLRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.