* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | OXYCHELIDONINE |
CAS: | 548-10-7 |
English Synonyms: | OXYCHELIDONINE |
MDL Number.: | MFCD00075745 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CN1[C@@H]2c3cc4c(cc3C[C@@H]([C@@H]2c5ccc6c(c5C1=O)OCO6)O)OCO4 |
InChi: | InChI=1S/C20H17NO6/c1-21-18-11-6-15-14(25-7-26-15)5-9(11)4-12(22)16(18)10-2-3-13-19(27-8-24-13)17(10)20(21)23/h2-3,5-6,12,16,18,22H,4,7-8H2,1H3/t12-,16-,18+/m0/s1 |
InChiKey: | InChIKey=UPVAYLMWVRMHNE-ULFGMLNVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.