* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RHIZOCARPIC ACID |
CAS: | 18463-11-1 |
English Synonyms: | RHIZOCARPIC ACID |
MDL Number.: | MFCD00075906 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | COC(=O)[C@H](Cc1ccccc1)NC(=O)/C(=C\2/C(=C(C(=O)O2)c3ccccc3)O)/c4ccccc4 |
InChi: | InChI=1S/C28H23NO6/c1-34-27(32)21(17-18-11-5-2-6-12-18)29-26(31)23(20-15-9-4-10-16-20)25-24(30)22(28(33)35-25)19-13-7-3-8-14-19/h2-16,21,30H,17H2,1H3,(H,29,31)/b25-23-/t21-/m0/s1 |
InChiKey: | InChIKey=DKDGWAKCXBFTMM-KFHWJWAOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.