* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISO-OSAJIN |
CAS: | 5745-54-0 |
English Synonyms: | ISO-OSAJIN |
MDL Number.: | MFCD00075923 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC1(CCc2c3c(c4c(c2O1)c(=O)c(co4)c5ccc(cc5)O)C=CC(O3)(C)C)C |
InChi: | InChI=1S/C25H24O5/c1-24(2)11-9-16-21(29-24)17-10-12-25(3,4)30-23(17)19-20(27)18(13-28-22(16)19)14-5-7-15(26)8-6-14/h5-9,11,13,26H,10,12H2,1-4H3 |
InChiKey: | InChIKey=FMCWKGDGAHVFMC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.