* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LUBIMIN |
| CAS: | 35951-50-9 |
| English Synonyms: | LUBIMIN |
| MDL Number.: | MFCD00075944 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C[C@@H]1C[C@@H](C[C@@H]([C@]12CC[C@H](C2)C(=C)C)C=O)O |
| InChi: | InChI=1S/C15H24O2/c1-10(2)12-4-5-15(8-12)11(3)6-14(17)7-13(15)9-16/h9,11-14,17H,1,4-8H2,2-3H3/t11-,12-,13-,14+,15+/m1/s1 |
| InChiKey: | InChIKey=CEVNHRPKRNTGKO-ZSAUSMIDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.